About 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione
6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione (PubChem CID 57395794) has the molecular formula C22H16N2O2S2
and a molecular weight of 404.52 g/mol. Its IUPAC name is 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione.
Molecular Properties
| Compound Name | 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione |
| PubChem CID | 57395794 |
| Molecular Formula | C22H16N2O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione |
| SMILES | Cc1ccc(SC2=C(Sc3ccc(C)cc3)C(=O)c3ncncc3C2=O)cc1 |
| InChI | InChI=1S/C22H16N2O2S2/c1-13-3-7-15(8-4-13)27-21-19(25)17-11-23-12-24-18(17)20(26)22(21)28-16-9-5-14(2)6-10-16/h3-12H,1-2H3 |
| InChIKey | BLWMUZDCLYRXKG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione?
The IUPAC name of 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione (CID 57395794) is 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione.
What is the SMILES notation for 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione?
The canonical SMILES for 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione is Cc1ccc(SC2=C(Sc3ccc(C)cc3)C(=O)c3ncncc3C2=O)cc1.
What is the InChIKey of 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione?
The InChIKey is BLWMUZDCLYRXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2S2/c1-13-3-7-15(8-4-13)27-21-19(25)17-11-23-12-24-18(17)20(26)22(21)28-16-9-5-14(2)6-10-16/h3-12H,1-2H3.
What are the key properties of 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione?
6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione has a molecular weight of 404.52 g/mol, XLogP of 5.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis[(4-methylphenyl)sulfanyl]quinazoline-5,8-dione is sourced from PubChem (CID 57395794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).