About 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine
8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine (PubChem CID 57395802) has the molecular formula C23H23FN6O2
and a molecular weight of 434.48 g/mol. Its IUPAC name is 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine.
Molecular Properties
| Compound Name | 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine |
| PubChem CID | 57395802 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine |
| SMILES | COc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCOCC4)c3n2)cc1 |
| InChI | InChI=1S/C23H23FN6O2/c1-31-17-8-6-15(7-9-17)26-22-25-14-20-21(29-22)30(16-10-12-32-13-11-16)23(28-20)27-19-5-3-2-4-18(19)24/h2-9,14,16H,10-13H2,1H3,(H,27,28)(H,25,26,29) |
| InChIKey | QXNPNLLIZGVUPQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine?
The IUPAC name of 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine (CID 57395802) is 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine.
What is the SMILES notation for 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine?
The canonical SMILES for 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine is COc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCOCC4)c3n2)cc1.
What is the InChIKey of 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine?
The InChIKey is QXNPNLLIZGVUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN6O2/c1-31-17-8-6-15(7-9-17)26-22-25-14-20-21(29-22)30(16-10-12-32-13-11-16)23(28-20)27-19-5-3-2-4-18(19)24/h2-9,14,16H,10-13H2,1H3,(H,27,28)(H,25,26,29).
What are the key properties of 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine?
8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine has a molecular weight of 434.48 g/mol, XLogP of 4.81, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-(oxan-4-yl)purine-2,8-diamine is sourced from PubChem (CID 57395802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).