C30H31N3O4 — CID 57395808
3-[(E)-[2,9-dimethoxy-6-(4-methoxyphenyl)indeno[1,2-c]quinolin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 57395808) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-[(E)-[2,9-dimethoxy-6-(4-methoxyphenyl)indeno[1,2-c]quinolin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(E)-[2,9-dimethoxy-6-(4-methoxyphenyl)indeno[1,2-c]quinolin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 57395808 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 3-[(E)-[2,9-dimethoxy-6-(4-methoxyphenyl)indeno[1,2-c]quinolin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc(-c2nc3ccc(OC)cc3c3c2-c2ccc(OC)cc2/C3=N\OCCCN(C)C)cc1 |
| InChI | InChI=1S/C30H31N3O4/c1-33(2)15-6-16-37-32-30-24-17-21(35-4)11-13-23(24)27-28(30)25-18-22(36-5)12-14-26(25)31-29(27)19-7-9-20(34-3)10-8-19/h7-14,17-18H,6,15-16H2,1-5H3/b32-30+ |
| InChIKey | MMEGXUNNIUTMAS-NHQGMKOOSA-N |
| XLogP | 5.63 |
| TPSA | 65.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|