About CID 57395876
CID 57395876 (PubChem CID 57395876) has the molecular formula C29H25ClN2O4S
and a molecular weight of 533.05 g/mol.
Molecular Properties
| Compound Name | CID 57395876 |
| PubChem CID | 57395876 |
| Molecular Formula | C29H25ClN2O4S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccccc2)C2CSCN2C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C29H25ClN2O4S/c1-35-23-10-17-13-28(26(33)19(17)12-24(23)36-2)25(16-6-4-3-5-7-16)22-14-37-15-32(22)29(28)20-11-18(30)8-9-21(20)31-27(29)34/h3-12,22,25H,13-15H2,1-2H3,(H,31,34) |
| InChIKey | RBPDBIRGGUXMDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 57395876 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57395876?
The IUPAC name of CID 57395876 (CID 57395876) is not available.
What is the SMILES notation for CID 57395876?
The canonical SMILES for CID 57395876 is COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccccc2)C2CSCN2C12C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of CID 57395876?
The InChIKey is RBPDBIRGGUXMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25ClN2O4S/c1-35-23-10-17-13-28(26(33)19(17)12-24(23)36-2)25(16-6-4-3-5-7-16)22-14-37-15-32(22)29(28)20-11-18(30)8-9-21(20)31-27(29)34/h3-12,22,25H,13-15H2,1-2H3,(H,31,34).
What are the key properties of CID 57395876?
CID 57395876 has a molecular weight of 533.05 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57395876 is sourced from PubChem (CID 57395876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).