C21H29FN2O2 — CID 57395887
6-ethoxy-N,N-diethyl-9-(2-(18F)fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide (PubChem CID 57395887) has the molecular formula C21H29FN2O2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 6-ethoxy-N,N-diethyl-9-(2-(18F)fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide.
| Compound Name | 6-ethoxy-N,N-diethyl-9-(2-(18F)fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 57395887 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 6-ethoxy-N,N-diethyl-9-(2-(18F)fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
| SMILES | CCOc1ccc2c(c1)c1c(n2CC[18F])CCCC1C(=O)N(CC)CC |
| InChI | InChI=1S/C21H29FN2O2/c1-4-23(5-2)21(25)16-8-7-9-19-20(16)17-14-15(26-6-3)10-11-18(17)24(19)13-12-22/h10-11,14,16H,4-9,12-13H2,1-3H3/i22-1 |
| InChIKey | NWTOHPLZYJPHQI-KVTPGWOSSA-N |
| XLogP | 4.30 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|