C33H48N2O2 — CID 57395910
1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 57395910) has the molecular formula C33H48N2O2 and a molecular weight of 504.76 g/mol. Its IUPAC name is 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 57395910 |
| Molecular Formula | C33H48N2O2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | CC(C)c1c(OCC(O)CN2CCN(c3ccccc3)CC2)ccc2c1CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C33H48N2O2/c1-24(2)31-27-12-15-30-32(3,4)16-9-17-33(30,5)28(27)13-14-29(31)37-23-26(36)22-34-18-20-35(21-19-34)25-10-7-6-8-11-25/h6-8,10-11,13-14,24,26,30,36H,9,12,15-23H2,1-5H3/t26?,30-,33+/m0/s1 |
| InChIKey | NMPLROITLQYWAS-IAQFZBRUSA-N |
| XLogP | 6.40 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |