C25H29N5O3S — CID 57396031
2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 57396031) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 57396031 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCCc1ccc(-c2csc(NC(=O)Cn3ccc4c3c(=O)n(C)c(=O)n4C)n2)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-4-5-6-7-8-17-9-11-18(12-10-17)19-16-34-24(26-19)27-21(31)15-30-14-13-20-22(30)23(32)29(3)25(33)28(20)2/h9-14,16H,4-8,15H2,1-3H3,(H,26,27,31) |
| InChIKey | AASDZFLETHTKKS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|