C34H44ClF2N3O5S — CID 57396100
(3R,3'S)-N-[[2-chloro-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-5,6-difluorospiro[1H-2-benzofuran-3,4'-piperidine]-3'-carboxamide (PubChem CID 57396100) has the molecular formula C34H44ClF2N3O5S and a molecular weight of 680.26 g/mol. Its IUPAC name is (3R,3'S)-N-[[2-chloro-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-5,6-difluorospiro[1H-2-benzofuran-3,4'-piperidine]-3'-carboxamide.
| Compound Name | (3R,3'S)-N-[[2-chloro-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-5,6-difluorospiro[1H-2-benzofuran-3,4'-piperidine]-3'-carboxamide |
|---|---|
| PubChem CID | 57396100 |
| Molecular Formula | C34H44ClF2N3O5S |
| Molecular Weight | 680.26 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | (3R,3'S)-N-[[2-chloro-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-5,6-difluorospiro[1H-2-benzofuran-3,4'-piperidine]-3'-carboxamide |
| SMILES | COCCCc1cc(CCCN2CCS(=O)(=O)CC2)c(Cl)c(CN(C(=O)[C@H]2CNCC[C@@]23OCc2cc(F)c(F)cc23)C2CC2)c1 |
| InChI | InChI=1S/C34H44ClF2N3O5S/c1-44-13-3-4-23-16-24(5-2-10-39-11-14-46(42,43)15-12-39)32(35)25(17-23)21-40(27-6-7-27)33(41)29-20-38-9-8-34(29)28-19-31(37)30(36)18-26(28)22-45-34/h16-19,27,29,38H,2-15,20-22H2,1H3/t29-,34+/m1/s1 |
| InChIKey | UYULRDAPYWFIRZ-SJHOIFEDSA-N |
| XLogP | 4.39 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|