About N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide
N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide (PubChem CID 57396265) has the molecular formula C15H23N3O2S3
and a molecular weight of 373.57 g/mol. Its IUPAC name is N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide |
| PubChem CID | 57396265 |
| Molecular Formula | C15H23N3O2S3 |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1nc(-c2ccsc2)cs1 |
| InChI | InChI=1S/C15H23N3O2S3/c1-12(2)23(19,20)17-8-5-3-4-7-16-15-18-14(11-22-15)13-6-9-21-10-13/h6,9-12,17H,3-5,7-8H2,1-2H3,(H,16,18) |
| InChIKey | PANOLYPJHRNFMC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The IUPAC name of N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide (CID 57396265) is N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The canonical SMILES for N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide is CC(C)S(=O)(=O)NCCCCCNc1nc(-c2ccsc2)cs1.
What is the InChIKey of N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The InChIKey is PANOLYPJHRNFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S3/c1-12(2)23(19,20)17-8-5-3-4-7-16-15-18-14(11-22-15)13-6-9-21-10-13/h6,9-12,17H,3-5,7-8H2,1-2H3,(H,16,18).
What are the key properties of N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide has a molecular weight of 373.57 g/mol, XLogP of 3.78, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide is sourced from PubChem (CID 57396265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).