C21H19N3O6S2 — CID 57396409
3-N,5-N-bis-(4-methylphenyl)sulfonylpyridine-3,5-dicarboxamide (PubChem CID 57396409) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-N,5-N-bis-(4-methylphenyl)sulfonylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis-(4-methylphenyl)sulfonylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 57396409 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 3-N,5-N-bis-(4-methylphenyl)sulfonylpyridine-3,5-dicarboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2cncc(C(=O)NS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-14-3-7-18(8-4-14)31(27,28)23-20(25)16-11-17(13-22-12-16)21(26)24-32(29,30)19-9-5-15(2)6-10-19/h3-13H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | MZLSZDVGCWNHOG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |