C18H14N2O2S — CID 57396448
4-[3-(hydroxymethyl)phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one (PubChem CID 57396448) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 4-[3-(hydroxymethyl)phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 57396448 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[3-(hydroxymethyl)phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one |
| SMILES | O=C1C2=C(NC(=S)NC2c2cccc(CO)c2)c2ccccc21 |
| InChI | InChI=1S/C18H14N2O2S/c21-9-10-4-3-5-11(8-10)15-14-16(20-18(23)19-15)12-6-1-2-7-13(12)17(14)22/h1-8,15,21H,9H2,(H2,19,20,23) |
| InChIKey | AVZYAMPJJDVPDJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|