C21H22Cl2FN3O2 — CID 57396514
[3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4-fluoropiperidin-1-yl)methanone (PubChem CID 57396514) has the molecular formula C21H22Cl2FN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4-fluoropiperidin-1-yl)methanone.
| Compound Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4-fluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 57396514 |
| Molecular Formula | C21H22Cl2FN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4-fluoropiperidin-1-yl)methanone |
| SMILES | O=C(N1CCC(F)CC1)N1CC(OC(c2ccc(Cl)cc2)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C21H22Cl2FN3O2/c22-15-5-3-14(4-6-15)19(18-2-1-9-25-20(18)23)29-17-12-27(13-17)21(28)26-10-7-16(24)8-11-26/h1-6,9,16-17,19H,7-8,10-13H2 |
| InChIKey | UCDXCMPPRKNQPN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|