C22H29N5O4 — CID 57396524
4-[[4-ethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57396524) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[[4-ethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-ethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57396524 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-[[4-ethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | CCc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCCOCCOC)n1 |
| InChI | InChI=1S/C22H29N5O4/c1-5-20-25-21(27-22(26-20)31-13-12-29-11-10-28-4)24-18-7-6-17(15-23)19(14-18)30-9-8-16(2)3/h6-8,14H,5,9-13H2,1-4H3,(H,24,25,26,27) |
| InChIKey | XHFIRPCVGHTYAU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|