C36H40N10O6 — CID 57396525
4-[[4-[4-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]butoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57396525) has the molecular formula C36H40N10O6 and a molecular weight of 708.78 g/mol. Its IUPAC name is 4-[[4-[4-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]butoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-[4-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]butoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57396525 |
| Molecular Formula | C36H40N10O6 |
| Molecular Weight | 708.78 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | 4-[[4-[4-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]butoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCCCCOc2nc(Nc3ccc(C#N)c(OCC=C(C)C)c3)nc(OC)n2)n1 |
| InChI | InChI=1S/C36H40N10O6/c1-23(2)13-17-49-29-19-27(11-9-25(29)21-37)39-31-41-33(47-5)45-35(43-31)51-15-7-8-16-52-36-44-32(42-34(46-36)48-6)40-28-12-10-26(22-38)30(20-28)50-18-14-24(3)4/h9-14,19-20H,7-8,15-18H2,1-6H3,(H,39,41,43,45)(H,40,42,44,46) |
| InChIKey | YOISZMBBBZSLOX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 204.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.78 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|