About 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one
1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 57396627) has the molecular formula C17H16ClFN4O2
and a molecular weight of 362.79 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 57396627 |
| Molecular Formula | C17H16ClFN4O2 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(N2CCOCC2)nc2n(Cc3ccc(F)c(Cl)c3)ccn12 |
| InChI | InChI=1S/C17H16ClFN4O2/c18-13-9-12(1-2-14(13)19)11-22-3-4-23-16(24)10-15(20-17(22)23)21-5-7-25-8-6-21/h1-4,9-10H,5-8,11H2 |
| InChIKey | BVGKBKHOLCLQFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one (CID 57396627) is 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one is O=c1cc(N2CCOCC2)nc2n(Cc3ccc(F)c(Cl)c3)ccn12.
What is the InChIKey of 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is BVGKBKHOLCLQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClFN4O2/c18-13-9-12(1-2-14(13)19)11-22-3-4-23-16(24)10-15(20-17(22)23)21-5-7-25-8-6-21/h1-4,9-10H,5-8,11H2.
What are the key properties of 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 362.79 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-chloro-4-fluorophenyl)methyl]-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 57396627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).