C18H15N3OS — CID 57396639
2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-1,3-thiazol-4-one (PubChem CID 57396639) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-1,3-thiazol-4-one.
| Compound Name | 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 57396639 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-1,3-thiazol-4-one |
| SMILES | O=C1CSC(N2N=C(c3ccccc3)CC2c2ccccc2)=N1 |
| InChI | InChI=1S/C18H15N3OS/c22-17-12-23-18(19-17)21-16(14-9-5-2-6-10-14)11-15(20-21)13-7-3-1-4-8-13/h1-10,16H,11-12H2 |
| InChIKey | ZJSPQEYXVVTWGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |