About 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one
2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one (PubChem CID 57396640) has the molecular formula C18H14ClN3OS
and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
| PubChem CID | 57396640 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
| SMILES | O=C1CSC(N2N=C(c3ccccc3)CC2c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C18H14ClN3OS/c19-14-8-6-13(7-9-14)16-10-15(12-4-2-1-3-5-12)21-22(16)18-20-17(23)11-24-18/h1-9,16H,10-11H2 |
| InChIKey | SDGNMBQUZIXYSU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one?
The IUPAC name of 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one (CID 57396640) is 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one.
What is the SMILES notation for 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one?
The canonical SMILES for 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one is O=C1CSC(N2N=C(c3ccccc3)CC2c2ccc(Cl)cc2)=N1.
What is the InChIKey of 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one?
The InChIKey is SDGNMBQUZIXYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3OS/c19-14-8-6-13(7-9-14)16-10-15(12-4-2-1-3-5-12)21-22(16)18-20-17(23)11-24-18/h1-9,16H,10-11H2.
What are the key properties of 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one?
2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one has a molecular weight of 355.85 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one is sourced from PubChem (CID 57396640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).