C16H28N6 — CID 57396677
1-[12-(1,2,4-triazol-1-yl)dodecyl]-1,2,4-triazole (PubChem CID 57396677) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-[12-(1,2,4-triazol-1-yl)dodecyl]-1,2,4-triazole.
| Compound Name | 1-[12-(1,2,4-triazol-1-yl)dodecyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 57396677 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-[12-(1,2,4-triazol-1-yl)dodecyl]-1,2,4-triazole |
| SMILES | c1ncn(CCCCCCCCCCCCn2cncn2)n1 |
| InChI | InChI=1S/C16H28N6/c1(3-5-7-9-11-21-15-17-13-19-21)2-4-6-8-10-12-22-16-18-14-20-22/h13-16H,1-12H2 |
| InChIKey | HBMOSLZSEYOCMD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|