C18H19N7O — CID 57396689
N-[[2-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-4-pyridinyl]methyl]acetamide (PubChem CID 57396689) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is N-[[2-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-4-pyridinyl]methyl]acetamide.
| Compound Name | N-[[2-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-4-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 57396689 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[[2-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-4-pyridinyl]methyl]acetamide |
| SMILES | CNc1nc2[nH]c(-c3cc(CNC(C)=O)ccn3)cc2c2c1ncn2C |
| InChI | InChI=1S/C18H19N7O/c1-10(26)21-8-11-4-5-20-13(6-11)14-7-12-16-15(22-9-25(16)3)18(19-2)24-17(12)23-14/h4-7,9H,8H2,1-3H3,(H,21,26)(H2,19,23,24) |
| InChIKey | LREWJGGYTDMQIN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |