C28H46O6Si — CID 57396749
[(3S,4E)-4-[2-[(1R,4aS,5R,6R,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] acetate (PubChem CID 57396749) has the molecular formula C28H46O6Si and a molecular weight of 506.76 g/mol. Its IUPAC name is [(3S,4E)-4-[2-[(1R,4aS,5R,6R,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] acetate.
| Compound Name | [(3S,4E)-4-[2-[(1R,4aS,5R,6R,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 57396749 |
| Molecular Formula | C28H46O6Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(3S,4E)-4-[2-[(1R,4aS,5R,6R,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] acetate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C1/C(=O)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H46O6Si/c1-18-10-13-23-27(6,21(18)12-11-20-22(34-19(2)29)16-32-25(20)31)15-14-24(30)28(23,7)17-33-35(8,9)26(3,4)5/h11,21-24,30H,1,10,12-17H2,2-9H3/b20-11+/t21-,22-,23+,24-,27+,28+/m1/s1 |
| InChIKey | VJSLAEHMOUSVLS-MWTXHCMUSA-N |
| XLogP | 5.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|