C20H29BrClN7O2 — CID 57396762
4-benzamidobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium bromide (PubChem CID 57396762) has the molecular formula C20H29BrClN7O2 and a molecular weight of 514.86 g/mol. Its IUPAC name is 4-benzamidobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium bromide.
| Compound Name | 4-benzamidobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 57396762 |
| Molecular Formula | C20H29BrClN7O2 |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 4-benzamidobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium bromide |
| SMILES | C[N+](C)(CCCCNC(=O)c1ccccc1)CCNC(=O)c1nc(Cl)c(N)nc1N.[Br-] |
| InChI | InChI=1S/C20H28ClN7O2.BrH/c1-28(2,12-7-6-10-24-19(29)14-8-4-3-5-9-14)13-11-25-20(30)15-17(22)27-18(23)16(21)26-15;/h3-5,8-9H,6-7,10-13H2,1-2H3,(H5-,22,23,24,25,27,29,30);1H |
| InChIKey | YADVIGVTXHTLBX-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|