About 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol
4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol (PubChem CID 57396772) has the molecular formula C19H15BrO5
and a molecular weight of 403.23 g/mol. Its IUPAC name is 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol |
| PubChem CID | 57396772 |
| Molecular Formula | C19H15BrO5 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2O)c2cc(Br)c(O)cc2O)cc1 |
| InChI | InChI=1S/C19H15BrO5/c20-15-8-14(17(24)9-18(15)25)19(10-1-3-11(21)4-2-10)13-6-5-12(22)7-16(13)23/h1-9,19,21-25H |
| InChIKey | CNTUMGUCPXXURE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol?
The IUPAC name of 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol (CID 57396772) is 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol.
What is the SMILES notation for 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol?
The canonical SMILES for 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol is Oc1ccc(C(c2ccc(O)cc2O)c2cc(Br)c(O)cc2O)cc1.
What is the InChIKey of 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol?
The InChIKey is CNTUMGUCPXXURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrO5/c20-15-8-14(17(24)9-18(15)25)19(10-1-3-11(21)4-2-10)13-6-5-12(22)7-16(13)23/h1-9,19,21-25H.
What are the key properties of 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol?
4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol has a molecular weight of 403.23 g/mol, XLogP of 4.16, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-[(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol is sourced from PubChem (CID 57396772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).