C35H47N3O6 — CID 57396874
(3R,6R,9S,13S)-9-benzhydryl-3-cyclohexyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 57396874) has the molecular formula C35H47N3O6 and a molecular weight of 605.78 g/mol. Its IUPAC name is (3R,6R,9S,13S)-9-benzhydryl-3-cyclohexyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6R,9S,13S)-9-benzhydryl-3-cyclohexyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 57396874 |
| Molecular Formula | C35H47N3O6 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.35 |
| IUPAC Name | (3R,6R,9S,13S)-9-benzhydryl-3-cyclohexyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](C(c2ccccc2)c2ccccc2)C(=O)N[C@H](CO)C(=O)N[C@H](C2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C35H47N3O6/c1-3-4-14-23(2)28-21-29(40)37-32(30(24-15-8-5-9-16-24)25-17-10-6-11-18-25)34(42)36-27(22-39)33(41)38-31(35(43)44-28)26-19-12-7-13-20-26/h5-6,8-11,15-18,23,26-28,30-32,39H,3-4,7,12-14,19-22H2,1-2H3,(H,36,42)(H,37,40)(H,38,41)/t23-,27+,28-,31+,32-/m0/s1 |
| InChIKey | YBYXVZONKTZEIB-ZCORBZMWSA-N |
| XLogP | 3.99 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |