About 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide
2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide (PubChem CID 57396924) has the molecular formula C21H21N7O3
and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide |
| PubChem CID | 57396924 |
| Molecular Formula | C21H21N7O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide |
| SMILES | COc1ccc(-c2nc(Nc3cccc(NC(=O)CN)c3)nc3nc[nH]c23)cc1OC |
| InChI | InChI=1S/C21H21N7O3/c1-30-15-7-6-12(8-16(15)31-2)18-19-20(24-11-23-19)28-21(27-18)26-14-5-3-4-13(9-14)25-17(29)10-22/h3-9,11H,10,22H2,1-2H3,(H,25,29)(H2,23,24,26,27,28) |
| InChIKey | ZHOWANFERDNTSO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide?
The IUPAC name of 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide (CID 57396924) is 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide.
What is the SMILES notation for 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide?
The canonical SMILES for 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide is COc1ccc(-c2nc(Nc3cccc(NC(=O)CN)c3)nc3nc[nH]c23)cc1OC.
What is the InChIKey of 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide?
The InChIKey is ZHOWANFERDNTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7O3/c1-30-15-7-6-12(8-16(15)31-2)18-19-20(24-11-23-19)28-21(27-18)26-14-5-3-4-13(9-14)25-17(29)10-22/h3-9,11H,10,22H2,1-2H3,(H,25,29)(H2,23,24,26,27,28).
What are the key properties of 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide?
2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide has a molecular weight of 419.45 g/mol, XLogP of 2.68, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]acetamide is sourced from PubChem (CID 57396924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).