C13H13N7O — CID 57396936
11-(furan-2-yl)-4-propyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine (PubChem CID 57396936) has the molecular formula C13H13N7O and a molecular weight of 283.29 g/mol. Its IUPAC name is 11-(furan-2-yl)-4-propyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine.
| Compound Name | 11-(furan-2-yl)-4-propyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 57396936 |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 11-(furan-2-yl)-4-propyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine |
| SMILES | CCCn1cc2nc(N)n3nc(-c4ccco4)nc3c2n1 |
| InChI | InChI=1S/C13H13N7O/c1-2-5-19-7-8-10(17-19)12-16-11(9-4-3-6-21-9)18-20(12)13(14)15-8/h3-4,6-7H,2,5H2,1H3,(H2,14,15) |
| InChIKey | ZAZPRMLVZGANMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |