C16H14N2O4 — CID 57397199
5-ethyl-2-phenylmethoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 57397199) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 5-ethyl-2-phenylmethoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-phenylmethoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 57397199 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-ethyl-2-phenylmethoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(OCc3ccccc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C16H14N2O4/c1-2-11-8-12(19)22-15-13(11)14(20)17-16(18-15)21-9-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3,(H,17,18,20) |
| InChIKey | AICBXIXJYABWJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |