C28H29F3N6O2 — CID 57397299
(3S,4R)-N-cyclopropyl-4-(3,4-difluorophenyl)-N-[[4-fluoro-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methyl]-4-hydroxypiperidine-3-carboxamide (PubChem CID 57397299) has the molecular formula C28H29F3N6O2 and a molecular weight of 538.57 g/mol. Its IUPAC name is (3S,4R)-N-cyclopropyl-4-(3,4-difluorophenyl)-N-[[4-fluoro-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methyl]-4-hydroxypiperidine-3-carboxamide.
| Compound Name | (3S,4R)-N-cyclopropyl-4-(3,4-difluorophenyl)-N-[[4-fluoro-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methyl]-4-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 57397299 |
| Molecular Formula | C28H29F3N6O2 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (3S,4R)-N-cyclopropyl-4-(3,4-difluorophenyl)-N-[[4-fluoro-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methyl]-4-hydroxypiperidine-3-carboxamide |
| SMILES | Cn1ncnc1Cn1cc(CN(C(=O)[C@H]2CNCC[C@]2(O)c2ccc(F)c(F)c2)C2CC2)c2c(F)cccc21 |
| InChI | InChI=1S/C28H29F3N6O2/c1-35-25(33-16-34-35)15-36-13-17(26-22(30)3-2-4-24(26)36)14-37(19-6-7-19)27(38)20-12-32-10-9-28(20,39)18-5-8-21(29)23(31)11-18/h2-5,8,11,13,16,19-20,32,39H,6-7,9-10,12,14-15H2,1H3/t20-,28+/m1/s1 |
| InChIKey | VAJPKQSBDSQSPA-NGOKVRLYSA-N |
| XLogP | 3.22 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |