C21H28N2O3 — CID 57397328
methyl 9-(3-morpholin-4-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57397328) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl 9-(3-morpholin-4-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-(3-morpholin-4-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57397328 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | methyl 9-(3-morpholin-4-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCN2CCOCC2)CCCC1 |
| InChI | InChI=1S/C21H28N2O3/c1-25-21(24)16-7-8-20-18(15-16)17-5-2-3-6-19(17)23(20)10-4-9-22-11-13-26-14-12-22/h7-8,15H,2-6,9-14H2,1H3 |
| InChIKey | JJWRBMIPWWLSSY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|