C24H28N4O4 — CID 57397330
methyl 9-[3-[(4-methoxycarbonyl-6-methylpyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57397330) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 9-[3-[(4-methoxycarbonyl-6-methylpyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-[(4-methoxycarbonyl-6-methylpyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57397330 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl 9-[3-[(4-methoxycarbonyl-6-methylpyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCNc2nc(C)cc(C(=O)OC)n2)CCCC1 |
| InChI | InChI=1S/C24H28N4O4/c1-15-13-19(23(30)32-3)27-24(26-15)25-11-6-12-28-20-8-5-4-7-17(20)18-14-16(22(29)31-2)9-10-21(18)28/h9-10,13-14H,4-8,11-12H2,1-3H3,(H,25,26,27) |
| InChIKey | DMZDZZKXODBIRV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|