C22H23N5O2 — CID 57397331
methyl 9-(3-purin-7-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57397331) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is methyl 9-(3-purin-7-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-(3-purin-7-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57397331 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | methyl 9-(3-purin-7-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCn2cnc3ncncc32)CCCC1 |
| InChI | InChI=1S/C22H23N5O2/c1-29-22(28)15-7-8-19-17(11-15)16-5-2-3-6-18(16)27(19)10-4-9-26-14-25-21-20(26)12-23-13-24-21/h7-8,11-14H,2-6,9-10H2,1H3 |
| InChIKey | FMGIOIHJVZEISC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|