C39H32IN7O7S2 — CID 57397355
5-[[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 57397355) has the molecular formula C39H32IN7O7S2 and a molecular weight of 901.76 g/mol. Its IUPAC name is 5-[[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 57397355 |
| Molecular Formula | C39H32IN7O7S2 |
| Molecular Weight | 901.76 g/mol |
| Exact Mass | 901.08 |
| IUPAC Name | 5-[[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)N(CCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21)C(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C39H32IN7O7S2/c1-19(2)46(10-3-11-47-36-34(35(41)42-17-43-36)45-39(47)56-32-16-31-30(15-27(32)40)52-18-53-31)38(55)44-20-4-7-23(26(12-20)37(50)51)33-24-8-5-21(48)13-28(24)54-29-14-22(49)6-9-25(29)33/h4-9,12-17,19,48H,3,10-11,18H2,1-2H3,(H,44,55)(H,50,51)(H2,41,42,43) |
| InChIKey | MAWBAERKPHLBIA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|