C23H22N4O2S — CID 57397373
N-[3-methoxy-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 57397373) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[3-methoxy-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | N-[3-methoxy-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 57397373 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[3-methoxy-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(Nc2nc3c(s2)CCCC3c2ccccc2)ccc1-c1nnc(C)o1 |
| InChI | InChI=1S/C23H22N4O2S/c1-14-26-27-22(29-14)18-12-11-16(13-19(18)28-2)24-23-25-21-17(9-6-10-20(21)30-23)15-7-4-3-5-8-15/h3-5,7-8,11-13,17H,6,9-10H2,1-2H3,(H,24,25) |
| InChIKey | VGHUJEFEILOOKQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |