C33H42F2N4O6S — CID 57397488
1-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-propylsulfonylpyrrolidin-2-yl]propan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 57397488) has the molecular formula C33H42F2N4O6S and a molecular weight of 660.78 g/mol. Its IUPAC name is 1-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-propylsulfonylpyrrolidin-2-yl]propan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-propylsulfonylpyrrolidin-2-yl]propan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 57397488 |
| Molecular Formula | C33H42F2N4O6S |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 1-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-propylsulfonylpyrrolidin-2-yl]propan-2-yl]-5-(1,3-oxazol-2-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]2C[C@@H](S(=O)(=O)CCC)CN2)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C33H42F2N4O6S/c1-4-8-39(9-5-2)33(42)24-16-22(15-23(17-24)32-36-7-10-45-32)31(41)38-29(14-21-12-25(34)18-26(35)13-21)30(40)28-19-27(20-37-28)46(43,44)11-6-3/h7,10,12-13,15-18,27-30,37,40H,4-6,8-9,11,14,19-20H2,1-3H3,(H,38,41)/t27-,28-,29+,30-/m1/s1 |
| InChIKey | YDOMJVDTZBDVFM-GKIKGMKOSA-N |
| XLogP | 4.14 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |