About butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate
butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate (PubChem CID 57397608) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate.
Molecular Properties
| Compound Name | butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate |
| PubChem CID | 57397608 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate |
| SMILES | CCCCOC(=O)CC1CC(c2ccc(OC)cc2)=NO1 |
| InChI | InChI=1S/C16H21NO4/c1-3-4-9-20-16(18)11-14-10-15(17-21-14)12-5-7-13(19-2)8-6-12/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | CJGLWLOVYFANBN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The IUPAC name of butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate (CID 57397608) is butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate.
What is the SMILES notation for butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The canonical SMILES for butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate is CCCCOC(=O)CC1CC(c2ccc(OC)cc2)=NO1.
What is the InChIKey of butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The InChIKey is CJGLWLOVYFANBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-3-4-9-20-16(18)11-14-10-15(17-21-14)12-5-7-13(19-2)8-6-12/h5-8,14H,3-4,9-11H2,1-2H3.
What are the key properties of butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate has a molecular weight of 291.35 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate is sourced from PubChem (CID 57397608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).