About CID 57397657
CID 57397657 (PubChem CID 57397657) has the molecular formula C29H24ClFN2O4S
and a molecular weight of 551.04 g/mol.
Molecular Properties
| Compound Name | CID 57397657 |
| PubChem CID | 57397657 |
| Molecular Formula | C29H24ClFN2O4S |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccc(F)cc2)C2CSCN2C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C29H24ClFN2O4S/c1-36-23-9-16-12-28(26(34)19(16)11-24(23)37-2)25(15-3-6-18(31)7-4-15)22-13-38-14-33(22)29(28)20-10-17(30)5-8-21(20)32-27(29)35/h3-11,22,25H,12-14H2,1-2H3,(H,32,35) |
| InChIKey | MQWRRSNPTMSQIY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 57397657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57397657?
The IUPAC name of CID 57397657 (CID 57397657) is not available.
What is the SMILES notation for CID 57397657?
The canonical SMILES for CID 57397657 is COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccc(F)cc2)C2CSCN2C12C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of CID 57397657?
The InChIKey is MQWRRSNPTMSQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24ClFN2O4S/c1-36-23-9-16-12-28(26(34)19(16)11-24(23)37-2)25(15-3-6-18(31)7-4-15)22-13-38-14-33(22)29(28)20-10-17(30)5-8-21(20)32-27(29)35/h3-11,22,25H,12-14H2,1-2H3,(H,32,35).
What are the key properties of CID 57397657?
CID 57397657 has a molecular weight of 551.04 g/mol, XLogP of 5.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57397657 is sourced from PubChem (CID 57397657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).