C31H40N3O3+ — CID 57397746
[(3R)-1-[3-(1,3-benzoxazol-2-yl)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57397746) has the molecular formula C31H40N3O3+ and a molecular weight of 502.68 g/mol. Its IUPAC name is [(3R)-1-[3-(1,3-benzoxazol-2-yl)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-[3-(1,3-benzoxazol-2-yl)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57397746 |
| Molecular Formula | C31H40N3O3+ |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | [(3R)-1-[3-(1,3-benzoxazol-2-yl)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CCCc3nc4ccccc4o3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C31H40N3O3/c1-31(25-11-4-2-5-12-25,33-18-8-3-9-19-33)30(35)37-28-23-34(21-16-24(28)17-22-34)20-10-15-29-32-26-13-6-7-14-27(26)36-29/h2,4-7,11-14,24,28H,3,8-10,15-23H2,1H3/q+1/t24?,28-,31-,34?/m0/s1 |
| InChIKey | QUYWVXBALJRRMH-YAFCZHNFSA-N |
| XLogP | 5.31 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|