C22H24N2O7S — CID 57397778
(E)-4-[2,4-dimethoxy-5-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 57397778) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is (E)-4-[2,4-dimethoxy-5-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2,4-dimethoxy-5-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57397778 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (E)-4-[2,4-dimethoxy-5-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2c3ccccc3CCC2C)cc1NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H24N2O7S/c1-14-8-9-15-6-4-5-7-17(15)24(14)32(28,29)20-12-16(18(30-2)13-19(20)31-3)23-21(25)10-11-22(26)27/h4-7,10-14H,8-9H2,1-3H3,(H,23,25)(H,26,27)/b11-10+ |
| InChIKey | RGWCTWGYEBDCNH-ZHACJKMWSA-N |
| XLogP | 2.81 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|