About 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one
3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 57397894) has the molecular formula C21H26N4O2
and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 57397894 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | CC(C)(O)c1ccc(-c2cnc3[nH]c(=O)n(CC4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-21(2,27)16-10-8-15(9-11-16)17-12-22-18-19(23-17)25(20(26)24-18)13-14-6-4-3-5-7-14/h8-12,14,27H,3-7,13H2,1-2H3,(H,22,24,26) |
| InChIKey | BHPWHRPVZOWBAN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one (CID 57397894) is 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one is CC(C)(O)c1ccc(-c2cnc3[nH]c(=O)n(CC4CCCCC4)c3n2)cc1.
What is the InChIKey of 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one?
The InChIKey is BHPWHRPVZOWBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-21(2,27)16-10-8-15(9-11-16)17-12-22-18-19(23-17)25(20(26)24-18)13-14-6-4-3-5-7-14/h8-12,14,27H,3-7,13H2,1-2H3,(H,22,24,26).
What are the key properties of 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one?
3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one has a molecular weight of 366.47 g/mol, XLogP of 3.59, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylmethyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-imidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 57397894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).