C8H12N2O4 — CID 57397904
5-(2-hydroxyethyl)-1-(methoxymethyl)pyrimidine-2,4-dione (PubChem CID 57397904) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1-(methoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 5-(2-hydroxyethyl)-1-(methoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57397904 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-(2-hydroxyethyl)-1-(methoxymethyl)pyrimidine-2,4-dione |
| SMILES | COCn1cc(CCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H12N2O4/c1-14-5-10-4-6(2-3-11)7(12)9-8(10)13/h4,11H,2-3,5H2,1H3,(H,9,12,13) |
| InChIKey | IJNAFILMXLQWFD-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |