C17H10N2O4S2 — CID 57397968
5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 57397968) has the molecular formula C17H10N2O4S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 57397968 |
| Molecular Formula | C17H10N2O4S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(-c2ccc3c(c2)COC3=O)s1 |
| InChI | InChI=1S/C17H10N2O4S2/c20-14-12(15(21)19-17(24)18-14)6-10-2-4-13(25-10)8-1-3-11-9(5-8)7-23-16(11)22/h1-6H,7H2,(H2,18,19,20,21,24) |
| InChIKey | PMHNLEVTQIKNGD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|