C24H30F2N6O2 — CID 57398025
8-N-(2,4-difluorophenyl)-2-N-(4-ethoxycyclohexyl)-9-(oxan-4-yl)purine-2,8-diamine (PubChem CID 57398025) has the molecular formula C24H30F2N6O2 and a molecular weight of 472.54 g/mol. Its IUPAC name is 8-N-(2,4-difluorophenyl)-2-N-(4-ethoxycyclohexyl)-9-(oxan-4-yl)purine-2,8-diamine.
| Compound Name | 8-N-(2,4-difluorophenyl)-2-N-(4-ethoxycyclohexyl)-9-(oxan-4-yl)purine-2,8-diamine |
|---|---|
| PubChem CID | 57398025 |
| Molecular Formula | C24H30F2N6O2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 8-N-(2,4-difluorophenyl)-2-N-(4-ethoxycyclohexyl)-9-(oxan-4-yl)purine-2,8-diamine |
| SMILES | CCOC1CCC(Nc2ncc3nc(Nc4ccc(F)cc4F)n(C4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C24H30F2N6O2/c1-2-34-18-6-4-16(5-7-18)28-23-27-14-21-22(31-23)32(17-9-11-33-12-10-17)24(30-21)29-20-8-3-15(25)13-19(20)26/h3,8,13-14,16-18H,2,4-7,9-12H2,1H3,(H,29,30)(H,27,28,31) |
| InChIKey | CVIOLLGCPOIEAU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |