C32H26ClN5O8 — CID 57398067
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-chloro-2-(hydroxyamino)purin-9-yl]-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 57398067) has the molecular formula C32H26ClN5O8 and a molecular weight of 644.04 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-chloro-2-(hydroxyamino)purin-9-yl]-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-chloro-2-(hydroxyamino)purin-9-yl]-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 57398067 |
| Molecular Formula | C32H26ClN5O8 |
| Molecular Weight | 644.04 g/mol |
| Exact Mass | 643.15 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-chloro-2-(hydroxyamino)purin-9-yl]-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)nc(NO)nc21 |
| InChI | InChI=1S/C32H26ClN5O8/c1-32(46-29(41)21-15-9-4-10-16-21)24(45-28(40)20-13-7-3-8-14-20)22(17-43-27(39)19-11-5-2-6-12-19)44-30(32)38-18-34-23-25(33)35-31(37-42)36-26(23)38/h2-16,18,22,24,30,42H,17H2,1H3,(H,35,36,37)/t22-,24-,30-,32-/m1/s1 |
| InChIKey | XCKVMFODMHHTHR-ZLZVUVTQSA-N |
| XLogP | 4.88 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.04 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|