C18H23N5O2S3 — CID 57398085
2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]-1,3-thiazole-5-sulfonamide (PubChem CID 57398085) has the molecular formula C18H23N5O2S3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 57398085 |
| Molecular Formula | C18H23N5O2S3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)NCCCCCNc2nc(-c3ccccn3)cs2)s1 |
| InChI | InChI=1S/C18H23N5O2S3/c1-13-17(27-14(2)22-13)28(24,25)21-11-6-3-5-10-20-18-23-16(12-26-18)15-8-4-7-9-19-15/h4,7-9,12,21H,3,5-6,10-11H2,1-2H3,(H,20,23) |
| InChIKey | BIZYCHPTCHHJOA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|