C23H24N4O — CID 57398122
2,7-bis[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one (PubChem CID 57398122) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 2,7-bis[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one.
| Compound Name | 2,7-bis[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one |
|---|---|
| PubChem CID | 57398122 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2,7-bis[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one |
| SMILES | O=C1c2cc(N3C[C@@H]4CN[C@@H]4C3)ccc2-c2ccc(N3C[C@@H]4CN[C@@H]4C3)cc21 |
| InChI | InChI=1S/C23H24N4O/c28-23-19-5-15(26-9-13-7-24-21(13)11-26)1-3-17(19)18-4-2-16(6-20(18)23)27-10-14-8-25-22(14)12-27/h1-6,13-14,21-22,24-25H,7-12H2/t13-,14-,21+,22+/m0/s1 |
| InChIKey | KYTFRTLVEMVJPY-HCIHMXRSSA-N |
| XLogP | 1.71 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |