C19H22FN7O3 — CID 57398214
(2S)-8-amino-7-fluoro-N'-hydroxy-6-(3-imidazol-1-ylpropylamino)-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboximidamide (PubChem CID 57398214) has the molecular formula C19H22FN7O3 and a molecular weight of 415.43 g/mol. Its IUPAC name is (2S)-8-amino-7-fluoro-N'-hydroxy-6-(3-imidazol-1-ylpropylamino)-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboximidamide.
| Compound Name | (2S)-8-amino-7-fluoro-N'-hydroxy-6-(3-imidazol-1-ylpropylamino)-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboximidamide |
|---|---|
| PubChem CID | 57398214 |
| Molecular Formula | C19H22FN7O3 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2S)-8-amino-7-fluoro-N'-hydroxy-6-(3-imidazol-1-ylpropylamino)-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboximidamide |
| SMILES | C[C@H]1COc2c(NCCCn3ccnc3)c(F)c(N)c3c(=O)c(/C(N)=N/O)cn1c23 |
| InChI | InChI=1S/C19H22FN7O3/c1-10-8-30-18-15(24-3-2-5-26-6-4-23-9-26)13(20)14(21)12-16(18)27(10)7-11(17(12)28)19(22)25-29/h4,6-7,9-10,24,29H,2-3,5,8,21H2,1H3,(H2,22,25)/t10-/m0/s1 |
| InChIKey | XKAGAANVUVPZPH-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|