C35H40N12O4 — CID 57398313
4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]propylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57398313) has the molecular formula C35H40N12O4 and a molecular weight of 692.78 g/mol. Its IUPAC name is 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]propylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]propylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57398313 |
| Molecular Formula | C35H40N12O4 |
| Molecular Weight | 692.78 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]propylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | COc1nc(NCCCNc2nc(Nc3ccc(C#N)c(OCC=C(C)C)c3)nc(OC)n2)nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)n1 |
| InChI | InChI=1S/C35H40N12O4/c1-22(2)12-16-50-28-18-26(10-8-24(28)20-36)40-32-42-30(44-34(46-32)48-5)38-14-7-15-39-31-43-33(47-35(45-31)49-6)41-27-11-9-25(21-37)29(19-27)51-17-13-23(3)4/h8-13,18-19H,7,14-17H2,1-6H3,(H2,38,40,42,44,46)(H2,39,41,43,45,47) |
| InChIKey | DXVXPNBEHKOAJF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 209.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.78 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|