C27H34O6 — CID 57398363
benzyl (1R,4S,5R,9R,10S,13R,14S)-13-hydroxy-5,9-dimethyl-15-oxospiro[16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-14,2'-oxirane]-5-carboxylate (PubChem CID 57398363) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is benzyl (1R,4S,5R,9R,10S,13R,14S)-13-hydroxy-5,9-dimethyl-15-oxospiro[16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-14,2'-oxirane]-5-carboxylate.
| Compound Name | benzyl (1R,4S,5R,9R,10S,13R,14S)-13-hydroxy-5,9-dimethyl-15-oxospiro[16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-14,2'-oxirane]-5-carboxylate |
|---|---|
| PubChem CID | 57398363 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | benzyl (1R,4S,5R,9R,10S,13R,14S)-13-hydroxy-5,9-dimethyl-15-oxospiro[16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-14,2'-oxirane]-5-carboxylate |
| SMILES | C[C@@]12CCC[C@@](C)(C(=O)OCc3ccccc3)[C@H]1CC[C@@]13C[C@](O)(CC[C@H]12)[C@@]1(CO1)C(=O)O3 |
| InChI | InChI=1S/C27H34O6/c1-23-11-6-12-24(2,21(28)31-15-18-7-4-3-5-8-18)19(23)9-13-25-16-26(30,14-10-20(23)25)27(17-32-27)22(29)33-25/h3-5,7-8,19-20,30H,6,9-17H2,1-2H3/t19-,20-,23+,24+,25+,26+,27+/m0/s1 |
| InChIKey | BRHCYAXOMYPZKT-VHRFJGKWSA-N |
| XLogP | 3.93 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|