C27H20N2O3 — CID 57398437
1'-benzyl-2-methylspiro[1H-benzo[f]isoindole-3,3'-indole]-2',4,9-trione (PubChem CID 57398437) has the molecular formula C27H20N2O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1'-benzyl-2-methylspiro[1H-benzo[f]isoindole-3,3'-indole]-2',4,9-trione.
| Compound Name | 1'-benzyl-2-methylspiro[1H-benzo[f]isoindole-3,3'-indole]-2',4,9-trione |
|---|---|
| PubChem CID | 57398437 |
| Molecular Formula | C27H20N2O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1'-benzyl-2-methylspiro[1H-benzo[f]isoindole-3,3'-indole]-2',4,9-trione |
| SMILES | CN1CC2=C(C(=O)c3ccccc3C2=O)C12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C27H20N2O3/c1-28-16-20-23(25(31)19-12-6-5-11-18(19)24(20)30)27(28)21-13-7-8-14-22(21)29(26(27)32)15-17-9-3-2-4-10-17/h2-14H,15-16H2,1H3 |
| InChIKey | GDNJNIUFRZTATA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|