About N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide
N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 57398472) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide |
| PubChem CID | 57398472 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)Nc2ccccc2)cc1NC(C)=O |
| InChI | InChI=1S/C16H18N2O5S/c1-11(19)17-13-9-16(15(23-3)10-14(13)22-2)24(20,21)18-12-7-5-4-6-8-12/h4-10,18H,1-3H3,(H,17,19) |
| InChIKey | LJZJFOIFDKKIFD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide?
The IUPAC name of N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide (CID 57398472) is N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide.
What is the SMILES notation for N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide?
The canonical SMILES for N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide is COc1cc(OC)c(S(=O)(=O)Nc2ccccc2)cc1NC(C)=O.
What is the InChIKey of N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide?
The InChIKey is LJZJFOIFDKKIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c1-11(19)17-13-9-16(15(23-3)10-14(13)22-2)24(20,21)18-12-7-5-4-6-8-12/h4-10,18H,1-3H3,(H,17,19).
What are the key properties of N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide?
N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide has a molecular weight of 350.40 g/mol, XLogP of 2.46, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-dimethoxy-5-(phenylsulfamoyl)phenyl]acetamide is sourced from PubChem (CID 57398472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).