C21H31BrClN7O2 — CID 57398531
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[(2-phenylacetyl)amino]butyl]azanium bromide (PubChem CID 57398531) has the molecular formula C21H31BrClN7O2 and a molecular weight of 528.88 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[(2-phenylacetyl)amino]butyl]azanium bromide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[(2-phenylacetyl)amino]butyl]azanium bromide |
|---|---|
| PubChem CID | 57398531 |
| Molecular Formula | C21H31BrClN7O2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[(2-phenylacetyl)amino]butyl]azanium bromide |
| SMILES | C[N+](C)(CCCCNC(=O)Cc1ccccc1)CCNC(=O)c1nc(Cl)c(N)nc1N.[Br-] |
| InChI | InChI=1S/C21H30ClN7O2.BrH/c1-29(2,12-7-6-10-25-16(30)14-15-8-4-3-5-9-15)13-11-26-21(31)17-19(23)28-20(24)18(22)27-17;/h3-5,8-9H,6-7,10-14H2,1-2H3,(H5-,23,24,25,26,28,30,31);1H |
| InChIKey | SMHXNDQZBUMILU-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|